
70356-09-1
| Name | Avobenzone |
| CAS | 70356-09-1 |
| EINECS(EC#) | 274-581-6 |
| Molecular Formula | C20H22O3 |
| MDL Number | MFCD00210252 |
| Molecular Weight | 310.39 |
| MOL File | 70356-09-1.mol |
Chemical Properties
| Melting point | 81-84 °C |
| Boiling point | 463.6±35.0 °C(Predicted) |
| density | 1.079 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | neat |
| pka | 9.74±0.13(Predicted) |
| color | White to Pale Yellow |
| Water Solubility | 27μg/L at 20℃ |
| λmax | 356nm(EtOH)(lit.) |
| Merck | 14,888 |
| Henry's Law Constant | 4.9×104 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | LIGHT STABILIZER UV ABSORBER UV FILTER |
| InChI | 1S/C20H22O3/c1-20(2,3)16-9-5-14(6-10-16)18(21)13-19(22)15-7-11-17(23-4)12-8-15/h5-12H,13H2,1-4H3 |
| InChIKey | GTIRDWBOUTYFQO-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)C(=O)CC(=O)c2ccc(cc2)C(C)(C)C |
| LogP | 6.1 at 20℃ |
Safety Data
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P273-P501 |
| Hazard Codes | N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 29145000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
| Hazardous Substances Data | 70356-09-1(Hazardous Substances Data) |

